ࡱ> ?A> S bjbj 4 SBBBBBVVVV bDVx$#######$p%"(X$Beee$BB2$e BB#e#o"h#Fo "#H$0x$"z(y^z( #z(B#8"$$ x$eeeez( : pH Worksheet What is pH a measure of? ______________________________________________ What is the equation used for finding pH? ________________________________ What is the equation that relates to pH and pOH? ____________________________ Complete the following table [H3O+][OH-]pHpOHAcidic/Basic?1.0 x 10-9 M4.1x10-2 M3.755.45 What would be the pH of each of the following: a) 0.0010 M HCl ____ g) 0.024 M HCl ____ b) 0.0010 M HNO3 ____ h) 0.075 M KOH ____ c) 0.010 M NaOH ____ i) 0.000034 M HCl ____ d) 0.0035 M HCl ____ j) 0.000000000001M HCl ____ e) 1.0 M HBr ____ f) 1.0 M KOH ____ A 2.63 g NaOH are dissolved in 156 mL of solution. Determine the NaOH concentration & the pH. [NaOH]= _________ pH= _________ List 3 strong acids and explain why these acids are considered strong acids. _____ ______ ______ _________________________________________________ List 3 weak acids and explain why these acids are considered weak acids. _____ ______ ______ _________________________________________________ List 2 strong bases and explain why these bases are considered strong bases. _____ ______ _________________________________________________ List 1 weak base and explain why it is considered a weak base. _____ ________________________________________________________          < > M O j } x i k C D    3 R S hSK^CJaJh]+9CJaJhSK^hSK^CJaJh>NMCJaJhSK^h]+95CJ\aJh#h]+9CJH*aJh#h]+9CJH*aJh#h]+9CJaJhSK^h@ CJaJhSK^h]+9CJaJ' WX    ! % 3 $$Ifa$gd# & Fgd]+9 h7$8$H$^hgd]+9 7$8$H$gd]+9 & F7$8$H$gd]+9$a$gd]+93 4 A B C D E K????? $$Ifa$gd#kd$$Iflr 4 \(((((( t0644 layt#E F G R S T U K????? $$Ifa$gd#kdu$$Iflr 4 \(((((( t0644 layt#U V W X ] ^ _ K????? $$Ifa$gd#kd$$Iflr 4 \(((((( t0644 layt#_ ` a b c h i K????? $$Ifa$gd#kd_$$Iflr 4 \(((((( t0644 layt#i j k KI<3 7$8$H$gd]+9 & F7$8$H$gd]+9kd$$Iflr 4 \(((((( t0644 layt# + a y   i j h7$8$H$^hgdSK^ & F7$8$H$gdSK^ W 7$8$H$gdSK^ 7$8$H$gd]+9 & F7$8$H$gd]+9xx7$8$H$^gd]+9 C D   S 7$8$H$gdSK^ 7$8$H$gd]+9 h7$8$H$^hgdSK^ & F7$8$H$gdSK^ 21h:pSK^/ =!"#$% s$$If!vh#v(:V l t065(yt#s$$If!vh#v(:V l t065(yt#s$$If!vh#v(:V l t065(yt#s$$If!vh#v(:V l t065(yt#s$$If!vh#v(:V l t065(yt#^ 2 0@P`p2( 0@P`p 0@P`p 0@P`p 0@P`p 0@P`p 0@P`p8XV~_HmH nH sH tH @`@ NormalCJ_HaJmH sH tH DA D Default Paragraph FontRi@R  Table Normal4 l4a (k (No List jj ]+9 Table Grid7:V0PK![Content_Types].xmlN0EH-J@%ǎǢ|ș$زULTB l,3;rØJB+$G]7O٭V$ !)O^rC$y@/yH*񄴽)޵߻UDb`}"qۋJחX^)I`nEp)liV[]1M<OP6r=zgbIguSebORD۫qu gZo~ٺlAplxpT0+[}`jzAV2Fi@qv֬5\|ʜ̭NleXdsjcs7f W+Ն7`g ȘJj|h(KD- dXiJ؇(x$( :;˹! I_TS 1?E??ZBΪmU/?~xY'y5g&΋/ɋ>GMGeD3Vq%'#q$8K)fw9:ĵ x}rxwr:\TZaG*y8IjbRc|XŻǿI u3KGnD1NIBs RuK>V.EL+M2#'fi ~V vl{u8zH *:(W☕ ~JTe\O*tHGHY}KNP*ݾ˦TѼ9/#A7qZ$*c?qUnwN%Oi4 =3N)cbJ uV4(Tn 7_?m-ٛ{UBwznʜ"Z xJZp; {/<P;,)''KQk5qpN8KGbe Sd̛\17 pa>SR! 3K4'+rzQ TTIIvt]Kc⫲K#v5+|D~O@%\w_nN[L9KqgVhn R!y+Un;*&/HrT >>\ t=.Tġ S; Z~!P9giCڧ!# B,;X=ۻ,I2UWV9$lk=Aj;{AP79|s*Y;̠[MCۿhf]o{oY=1kyVV5E8Vk+֜\80X4D)!!?*|fv u"xA@T_q64)kڬuV7 t '%;i9s9x,ڎ-45xd8?ǘd/Y|t &LILJ`& -Gt/PK! ѐ'theme/theme/_rels/themeManager.xml.relsM 0wooӺ&݈Э5 6?$Q ,.aic21h:qm@RN;d`o7gK(M&$R(.1r'JЊT8V"AȻHu}|$b{P8g/]QAsم(#L[PK-![Content_Types].xmlPK-!֧6 0_rels/.relsPK-!kytheme/theme/themeManager.xmlPK-!0C)theme/theme/theme1.xmlPK-! ѐ' theme/theme/_rels/themeManager.xml.relsPK] S S 3 E U _ i S  8@0(  B S  ?::UU9*urn:schemas-microsoft-com:office:smarttagsState9*urn:schemas-microsoft-com:office:smarttagsplace UUxyRRUU> $'y >.mq;Gg?̞^m%_x.#h ^`o(hH. ^`hH. pLp^p`LhH. @ @ ^@ `hH. ^`hH. L^`LhH. ^`hH. ^`hH. PLP^P`LhH.h ^`o(hH. ^`hH. pLp^p`LhH. @ @ ^@ `hH. ^`hH. L^`LhH. ^`hH. ^`hH. PLP^P`LhH.h ^`o(hH.h ^`hH.h pLp^p`LhH.h @ @ ^@ `hH.h ^`hH.h L^`LhH.h ^`hH.h ^`hH.h PLP^P`LhH.h ^`o(hH.h ^`hH.h pLp^p`LhH.h @ @ ^@ `hH.h ^`hH.h L^`LhH.h ^`hH.h ^`hH.h PLP^P`LhH.h ^`hH.h ^`hH.h pLp^p`LhH.h @ @ ^@ `hH.h ^`hH.h L^`LhH.h ^`hH.h ^`hH.h PLP^P`LhH.m%_xy q;> g?b        b        b        b                 #@ 4&]+9>NM1ZSK^ :SU@Sx@UnknownG*Ax Times New Roman5Symbol3. *Cx ArialA$BCambria Math"qhcU,gcU,gaf  !r4QQ 3QHP)?]+92!xx  pH WorksheetGCCCDVances      Oh+'0L    ,4<DpH WorksheetGCCCDNormalVances2Microsoft Office Word@@N&n@Z4@Z4՜.+,0 hp  GCCCD Q  pH Worksheet Title  !"#$%&'()*+,-/012345789:;<=@Root Entry Fi FBData 1Table(WordDocument4 SummaryInformation(.DocumentSummaryInformation86CompObjr  F Microsoft Word 97-2003 Document MSWordDocWord.Document.89q